免费注册 请登录
当前位置:首页>详情说明
详情说明

常用晶体管 NPN-PNP|长电

发布: 2020/1/13 0:54:13

分立器件_晶体管-长电


分立器件_晶体管-长电 NPN选型PNP封装对照,参数资料表
型号极性Pcx(mW)Ic(mA)BVCBO(V)BVCEO(V)BVEBO(V)MinMaxVCE(sat)(V)封装形式
2N3828NPN30010040403302000.3TO-92
2N3904NPN625200604061004000.3TO-92
2N3906PNP625200404051004000.4TO-92
2N4124NPN350200302551203600.3TO-92
2N4126PNP625200252541203600.4TO-92
2N4400NPN62560060406501500.75TO-92
2N4401NPN625600604061003000.75TO-92
2N4402PNP62560040405501500.75TO-92
2N4403PNP625600404051003000.75TO-92
2N5087PNP62550505032508000.3TO-92
2N5172NPN625500252551005000.25TO-92
2N5400PNP6256001301205401800.5TO-92
2N5401PNP6256001601505603000.5TO-92
2N5550NPN6256001601406602500.25TO-92
2N5551NPN6256001801606803000.2TO-92
2N5551KNPN6256001801606803000.2TO-92
2N5832NPN62560016014051755000.25TO-92
2N6517NPN6255003503506302001TO-92
2N6520PNP6255003503505302001TO-92
2N6718NPN62510001001005502500.35TO-92
2N6727PNP1000150050405502500.5TO-92
2PD601AWNPN200100605061604600.5SOT-323
2SA1012PNP2000500060505702400.4TO-220-3L
2SA1012PNP1250500060505702400.4TO-252-2L(4R)
2SA1012BPNP1250200050506822700.35TO-252-2L(4R)
2SA1013PNP50010001601606603201.5SOT-89-3L
2SA1013PNP90010001601606603201.5TO-92L
2SA1013PNP90010001601606603201.5TO-92MOD
2SA1015PNP40015050505704000.3TO-92
2SA1020PNP900200050505702400.5TO-92L
2SA1020PNP900200050505702400.5TO-92
2SA1020PNP900200050505702400.5TO-92MOD
2SA1036PNP20050040325823900.4SOT-23
2SA1037PNP200150605061205600.5SOT-23
2SA1048PNP20015050505704000.3TO-92S
2SA1048PNP20015050505704000.3TO-92
2SA1081PNP400100909052508000.2TO-92
2SA1082PNP40010012012052508000.2TO-92
2SA1083PNP400100606052508000.2TO-92
2SA1084PNP400100909052508000.2TO-92
2SA1145PNP800501501505802401TO-92MOD
2SA1160PNP9002000201061406000.5TO-92L
2SA1160PNP9002000201061406000.5TO-92MOD
2SA1162PNP15015050505704000.3SOT-23
2SA1179PNP200150555052004000.5SOT-23
2SA1201PNP5008001201205802401SOT-89-3L
2SA1203PNP5001500303051003202SOT-89-3L
2SA1204PNP500800353051003200.7SOT-89-3L
2SA1213PNP500200050505702400.5SOT-89-3L
2SA1225PNP100015001601605702401.5TO-252-2L(4R)
2SA1235APNP200200605061505000.3SOT-23
2SA1242PNP10005000352081003201TO-251-3L
2SA1242PNP10005000352081003201TO-252-2L(4R)
2SA1267PNP40015050505707000.25TO-92S
2SA1283PNP900100060606553000.3TO-92MOD
2SA1296PNP7502000202061204000.5TO-92
2SA1298PNP200800353051003200.4SOT-23
2SA1300PNP7502000201061406000.82TO-92
2SA1309APNP300100605071604600.3TO-92S
2SA1313PNP20050050505702400.25SOT-23
2SA1317PNP300200605061005600.3TO-92S
2SA1318PNP500200605061005600.3TO-92
2SA1371PNP10001003003005403200.6TO-92MOD
2SA1515PNP500100040325823900.5TO-92
2SA1515SPNP300100040325823900.5TO-92S
2SA1576APNP200150605061205600.5SOT-323
2SA1577PNP20050040325823900.4SOT-323
2SA1579PNP1005012012051805600.5SOT-323
2SA1585PNP3502000202061203900.5SOT-23
2SA1585SPNP4002000202061205600.5TO-92S
2SA1586PNP10015050505704000.3SOT-323
2SA1611PNP15010060505906000.3SOT-323
2SA1615PNP1000100003020102006000.25TO-251-3L
2SA1615PNP1000100003020102006000.25TO-252-2L(4R)
2SA1625PNP7505004004007402000.5TO-92
2SA1633PNP3500100001501506603202.5TO-247
2SA1661PNP5008001201205802401SOT-89-3L
2SA1662PNP50040080805702400.4SOT-89-3L
2SA1664PNP500800353051003200.7SOT-89-3L
2SA1700PNP10002004004005602000.8TO-251-3L
2SA1700PNP10002004004005602000.8TO-252-2L(4R)
2SA1740PNP5002004004005602000.6SOT-89-3L
2SA1774PNP150150605061205600.5SOT-523
2SA1797PNP500200050506822700.35SOT-89-3L
2SA1832PNP100150505051204000.3SOT-523
2SA1943PNP3500150002302305551603TO-3P
2SA1952PNP100050001006051202700.3TO-252-2L(4R)
2SA1980PNP62515050505707000.3TO-92
2SA1981PNP625800353051003200.5TO-92
2SA2018PNP150500151262706800.25SOT-523
2SA2029PNP150150605061205600.5SOT-723
2SA2050PNP150015001801606602401TO-220F
2SA554PNP50020001001006822700.3SOT-89-3L
2SA562PNP50050035305702400.25TO-92
2SA608NPNP500150605061605600.3TO-92
2SA608SPNP30010040305605600.5TO-92S
2SA673PNP40050035354603200.6TO-92
2SA673APNP40050050504603200.6TO-92
2SA683PNP750100030255853400.4TO-92L
2SA684PNP750100060505853400.4TO-92L
2SA719PNP62550030255853400.6TO-92
2SA720PNP62550060505853400.6TO-92
2SA812PNP20010060505906000.3SOT-23
2SA817APNP80040080805702400.4TO-92MOD
2SA821PNP250302102105562700.6TO-92
2SA821SPNP250302102105562700.6TO-92S
2SA836PNP200100555551605000.5TO-92
2SA844PNP300100555551608000.5TO-92
2SA854SPNP200500403251203900.4TO-92S
2SA933ASPNP300150605061205600.5TO-92S
2SA935PNP75070080805823900.4TO-92L
2SA940PNP150015001501505401401.5TO-220-3L
2SA950PNP600800353051003200.7TO-92
2SA965PNP9008001201205802401TO-92MOD
2SA966PNP9001500303051003202TO-92L
2SA966PNP9001500303051003202TO-92MOD
2SB1068PNP6252000201661356500.5TO-92
2SB1073PNP5004000302071203151SOT-89-3L
2SB1116PNP3501000605061356000.3SOT-23
2SB1116PNP7501000605061356000.3TO-92
2SB1116APNP7501000806061356000.3TO-92
2SB1132PNP500100040325823900.5SOT-89-3L
2SB1167*PNP125030001201006702800.5TO-126
2SB1182PNP1500200040325823900.8TO-251-3L
2SB1182PNP1500200040325823900.8TO-252-2L(4R)
2SB1184PNP1000300060505823901TO-251-3L
2SB1184PNP1000300060505823901TO-252-2L(4R)
2SB1185PNP2000300060505603201TO-220-3L
2SB1188PNP500200040325823900.8SOT-89-3L
2SB1189PNP50070080805823900.4SOT-89-3L
2SB1197PNP20080040325823900.5SOT-23
2SB1198PNP200500808051203900.5SOT-23
2SB1202PNP10003000605061005600.7TO-251-3L
2SB1202PNP10003000605061005600.7TO-252-2L(4R)
2SB1218APNP150100454571604600.5SOT-323
2SB1260PNP500100080805823900.4SOT-89-3L
2SB1261PNP10003000606071004000.3TO-252-2L(4R)
2SB1261-ZPNP10003000606071004000.3TO-251-3L
2SB1274PNP2000300060606702801TO-220-3L
2SB1308PNP500300030206823900.45SOT-89-3L
2SB1322APNP625100060505853400.4TO-92
2SB1370PNP20003000606051003201.5TO-220F
2SB1375PNP20003000606071003201.5TO-220-3L
2SB1386PNP500500030206823901SOT-89-3L
2SB1412PNP1000500030206823901TO-251-3L
2SB1412PNP1000500030206823901TO-252-2L(4R)
2SB1412*PNP8005000302061803901SOT-223(8R)
2SB1424PNP5003000202061203900.5SOT-89-3L
2SB1426PNP750300020206823900.5TO-92
2SB1440PNP5002000505051203400.3SOT-89-3L
2SB1568PNP20004000808071000100001.5TO-220F
2SB1658PNP10005000303061506000.5TO-126
2SB1694PNP2001000303062706800.38SOT-323
2SB507PNP1750300060605403201TO-220-3L
2SB560PNP900700100805605600.8TO-92MOD
2SB561PNP50070025205852400.5TO-92
2SB562PNP750100025205852400.5TO-92L
2SB562PNP625100025205852400.5TO-92
2SB624PNP200700302551104000.6SOT-23
2SB647PNP7501000120805603201TO-92L
2SB647PNP9001000120805603201TO-92MOD
2SB647APNP90010001201005602001TO-92MOD
2SB649PNP90015001801205603201TO-92L
2SB649PNP100015001801205603201TO-126
2SB649APNP90015001801605602001TO-92L
2SB649APNP100015001801605602001TO-126
2SB688PNP300080001201205551602.5TO-3P
2SB709APNP200100454571604600.5SOT-23
2SB740PNP9001000705061003200.6TO-92MOD
2SB764PNP900100060505603200.7TO-92MOD
2SB764PNP750100060505603200.7TO-92L
2SB766PNP500100030255853400.4SOT-89-3L
2SB766APNP500100060505853400.4SOT-89-3L
2SB772PNP2000300040306604000.5TO-220-3L
2SB776PNP10003000505051004000.5TO-126
2SB817*PNP3000120001601406602002TO-3P
2SB834PNP1500300060607602001TO-220-3L
2SB834PNP1500300060607602001TO-220F
2SB857PNP2000400070505603201TO-220-3L
2SB861PNP180020002001506602003TO-220-3L
2SB892PNP10002000605061005600.4TO-92MOD
2SB892PNP7502000605061005600.4TO-92L
2SB927PNP10002500302561005600.6TO-92MOD
2SB946PNP20007000130807602600.5TO-220F
2SB985PNP9003000605061005600.7TO-92MOD
2SC1008NPN80070080608404000.4TO-92
2SC1162NPN1000250035355603201TO-126
2SC1213NPN40050035354603200.6TO-92
2SC1213ANPN40050050504603200.6TO-92
2SC1318NPN62550060507853400.6TO-92
2SC1318ANPN75050080705853400.6TO-92
2SC1359NPN4003030205702200.2TO-92
2SC1383NPN750100030255853401.2TO-92L
2SC1383NPN1000100030255853400.4TO-92MOD
2SC1384NPN750100060505853401.2TO-92L
2SC1384NPN1000100060505853400.4TO-92MOD
2SC1623NPN20010060505906000.3SOT-323
2SC1623NPN20010060505906000.3SOT-23
2SC1627ANPN80040080805702400.4TO-92MOD
2SC1627ANPN75040080805702400.4TO-92L
2SC1654NPN150501801605904000.3SOT-23
2SC1674NPN2502030204401800.3TO-92
2SC1675NPN6255050305402400.3TO-92
2SC1740SNPN300150605071205600.4TO-92S
2SC1741SNPN200500403251205600.4TO-92S
2SC1766NPN500200050505823900.5SOT-89-3L
2SC1815NPN40015060505707000.25TO-92
2SC1923NPN100204030440200-TO-92
2SC1959NPN50050035305704000.25TO-92
2SC1959NPN50050035305704000.25TO-92S
2SC2001NPN60070030255904000.6TO-92
2SC2060NPN750100040325804000.4TO-92L
2SC2060NPN750100040325804000.4TO-92MOD
2SC2073NPN150015001501505401401.5TO-220-3L
2SC2120NPN600800353051003200.5TO-92
2SC2130NPN600800454051003200.5TO-92
2SC2216NPN3005050454401400.2TO-92
2SC2229NPN800502001505702400.5TO-92MOD
2SC2230NPN80010020016051204000.5TO-92MOD
2SC2230ANPN80010020018051204000.5TO-92L
2SC2235NPN9008001201205802401TO-92L
2SC2235NPN9008001201205802401TO-92MOD
2SC2236NPN9001500303051003202TO-92L
2SC2236NPN9001500303051003202TO-92MOD
2SC2274NPN60050060505603200.6TO-92
2SC2314NPN750100075455603200.6TO-126
2SC2383NPN500100016016061003201SOT-89-3L
2SC2383NPN90010001601606603201TO-92L
2SC2383NPN90010001601606603201TO-92MOD
2SC2389SNPN3005012012051805600.5TO-92S
2SC2411NPN20050040325823900.4SOT-23
2SC2412NPN200150605071205600.4SOT-23
2SC2458NPN20015050505707000.25TO-92S
2SC2482NPN9001003003007301501TO-92L
2SC2482NPN9001003003007301501TO-92MOD
2SC2500NPN9002000301061406000.5TO-92L
2SC2500NPN9002000301061406000.5TO-92MOD
2SC2551NPN4001003003006301500.5TO-92
2SC2655NPN900200050505702400.5TO-92L
2SC2655NPN900200050505702400.5TO-92MOD
2SC2668NPN200204030440200-TO-92S
2SC2688NPN12502003003005402500.5TO-126
2SC2703NPN7501000303051003200.5TO-92L
2SC2703NPN9001000303051003200.5TO-92MOD
2SC2712NPN15015060505707000.25SOT-23
2SC2714NPN100204030440200-SOT-23
2SC2715NPN3505035304402400.4SOT-23
2SC2717NPN3005030254903200.2TO-92
2SC2785NPN250100605051106000.3TO-92S
2SC2839NPN400303020560320-TO-92S
2SC2859NPN15050035305704000.25SOT-23
2SC2873NPN500200050505702400.5SOT-89-3L
2SC2878ANPN40030050201520012000.3TO-92
2SC2881NPN5008001201205802401SOT-89-3L
2SC2883NPN5001500303051003202SOT-89-3L
2SC2884NPN500800353051003200.5SOT-89-3L
2SC2983NPN100015001601605702401.5TO-251-3L
2SC2983NPN100015001601605702401.5TO-252-2L(4R)
2SC2983NPN200015001601605702401.5TO-220F
2SC2999NPN400302520340200-TO-92S
2SC3052NPN150200505061508000.3SOT-23
2SC3138NPN3505020020051202400.5SOT-23-3L
2SC3149NPN2000500900800710401TO-220-3L
2SC3199NPN40015050505707000.25TO-92
2SC3199NPN40015050505707000.25TO-92S
2SC3243NPN900100060606553000.3TO-92MOD
2SC3279NPN7502000301061406000.82TO-92
2SC3303NPN10005000100807702400.4TO-251-3L
2SC3303NPN10005000100807702400.4TO-252-2L(4R)
2SC3303NPN10005000100807702400.4TO-251S
2SC3311ANPN300100605071604600.3TO-92S
2SC3330NPN300200605061008000.3TO-92S
2SC3415NPN5001003003005391802TO-92
2SC3420NPN15005000502081406001TO-126
2SC3437NPN15020040155402400.3SOT-23
2SC3650NPN500120030251580032000.5SOT-89-3L
2SC380TMNPN3005035304402400.4TO-92
2SC388NPN3005030254202000.2TO-92
2SC3930NPN150303020570220-SOT-323
2SC4003NPN10002004004005602000.6TO-251-3L
2SC4003NPN10002004004005602000.6TO-252-2L(4R)
2SC4081NPN200150605071205600.4SOT-323
2SC4097NPN20050040325823900.4SOT-323
2SC4098NPN2005040255562700.3SOT-323
2SC4102NPN2005012012051805600.5SOT-323
2SC4115NPN5003000402061205600.5SOT-89-3L
2SC4115SNPN3003000402061205600.5TO-92S
2SC4116NPN10015060505707000.25SOT-323
2SC4177NPN15010060505906000.3SOT-323
2SC4180NPN1505012012051359000.3SOT-323
2SC4215NPN100204030440200-SOT-323
2SC4272NPN500100075455603200.6SOT-89-3L
2SC4373NPN5008001201205802401SOT-89-3L
2SC4374NPN50040080805702400.4SOT-89-3L
2SC4375NPN5001500303051003202SOT-89-3L
2SC4544NPN20001003003007302001TO-220-3L
2SC4548NPN5002004004005602000.6SOT-89-3L
2SC4617NPN150150605071205600.4SOT-523
2SC4618NPN1505040255562700.3SOT-523
2SC4672NPN500200060506823900.35SOT-89-3L
2SC4738NPN100150605051207000.25SOT-523
2SC5171NPN2000200018018051003201TO-220F
2SC5198NPN3500100001401405551602TO-3P
2SC5200NPN3500150002302305551603TO-3P
2SC5287NPN35005000900550710250.5TO-3P
2SC5343NPN20015060505707000.25SOT-23
2SC5343NPN62515060505707000.25TO-92
2SC5344NPN200800353051003200.5SOT-23
2SC5344NPN625800353051003200.5TO-92
2SC5345NPN3002030204402400.3SOT-23
2SC5345NPN6252030204402400.3TO-92
2SC536NPN40010040305609600.5TO-92
2SC536NNPN625150605061605600.3TO-92
2SC536SNPN30010040305609600.5TO-92S
2SC554NPN50020001001006822700.3SOT-89-3L
2SC5585NPN150500151262706800.25SOT-523
2SC5658NPN100150605071205600.4SOT-723
2SC5663NPN150500151262706800.25SOT-723
2SC5785NPN50020002010740010000.12SOT-89-3L
2SD0602NPN20050030255853400.6SOT-23
2SD0602ANPN20050060505853400.6SOT-23
2SD1005NPN5001000100805904000.5SOT-89-3L
2SD1037NPN350030000150120620-0.5TO-3P
2SD1047*NPN3000120001601406602002TO-3P
2SD1119NPN5003000402572306001SOT-89-3L
2SD1138NPN180020002001506602003TO-220-3L
2SD1247NPN10002500302561005600.4TO-92MOD
2SD1271ANPN200070001501007602600.5TO-220F
2SD1306NPN150700301552508000.5SOT-23
2SD1468NPN6251000301551205600.4TO-92
2SD1468SNPN3001000301551205600.4TO-92S
2SD1499NPN125050001001005602002TO-252-2L(4R)
2SD1499NPN200050001001005602002TO-220F
2SD1513NPN6252000201661356500.4TO-92
2SD1616NPN7501000605061356000.3TO-92
2SD1616ANPN50010001206061356000.3SOT-89-3L
2SD1616ANPN75010001206061356000.3TO-92
2SD1664NPN500100040325823900.4SOT-89-3L
2SD1724NPN125030001201006702800.4TO-126
2SD1757KNPN20050030156.51205600.4SOT-23
2SD1758NPN1200200040325823900.8TO-251-3L
2SD1758NPN1200200040325823900.8TO-252-2L(4R)
2SD1760NPN1500300060505823901TO-251-3L
2SD1760NPN1500300060505823901TO-252-2L(4R)
2SD1760NPN1500300060505823901TO-251S
2SD1761NPN2000300080605603201TO-220F
2SD1762NPN2000300060505603201TO-220-3L
2SD1766NPN500200040325823900.8SOT-89-3L
2SD1767NPN50070080805823900.4SOT-89-3L
2SD1781NPN200800403251203900.4SOT-23
2SD1782NPN200500808051203900.5SOT-23
2SD1802NPN10003000605061005600.5TO-251-3L
2SD1802NPN10003000605061005600.5TO-252-2L(4R)
2SD1815NPN100030001201006704000.4TO-251-3L
2SD1815NPN100030001201006704000.4TO-252-2L(4R)
2SD1815NPN200030001201006704000.4TO-220F
2SD1815NPN100030001201006704000.4TO-251S
2SD1819ANPN150100605071604600.3SOT-323
2SD1835NPN7502000605061005600.4TO-92
2SD1898NPN5001000100805823900.4SOT-89-3L
2SD1899NPN10003000606071004000.25TO-252-2L(4R)
2SD1899-ZNPN10003000606071004000.25TO-251-3L
2SD1991ANPN400100605071604600.3TO-92
2SD1994ANPN625100060505853400.4TO-92
2SD2012NPN20003000606071003201TO-220-3L
2SD2012NPN20003000606071003201TO-220F
2SD2012NPN23606071003201TO-263-2L
2SD2061NPN20003000806051003201TO-220F
2SD2061NPN20003000806051003201TO-220-3L
2SD2097NPN6255000502061203901TO-92
2SD2098NPN5005000502061203901SOT-89-3L
2SD2114NPN25050025201282027000.4SOT-23
2SD2118NPN10005000502061203901TO-251-3L
2SD2118NPN10005000502061203901TO-252-2L(4R)
2SD2136NPN1250300060606402501.2TO-126
2SD2137NPN2000300060606703201.2TO-220-3L
2SD2137NPN2000300060606703201.2TO-220F
2SD2137ANPN2000300080806703201.2TO-220-3L
2SD2150NPN5003000402061805600.5SOT-89-3L
2SD2152NPN7003000222261809500.4TO-92
2SD2153NPN50020003025656027000.5SOT-89-3L
2SD2391NPN5002000606061202700.35SOT-89-3L
2SD2396NPN200030008060640020000.8TO-220F
2SD2413NPN500100400400530-1.5SOT-89-3L
2SD2470NPN4005000151082708200.5TO-92S
2SD2583NPN10005000303061506000.5TO-126
2SD313NPN1750300060605403201TO-220-3L
2SD400NPN750100025255605600.3TO-92L
2SD400NPN900100025255605600.3TO-92MOD
2SD468NPN750100025205852400.5TO-92L
2SD468NPN900100025205852400.5TO-92MOD
2SD596NPN200700302551104000.6SOT-23
2SD601ANPN200100605071604600.3SOT-23
2SD602NPN20050030255853400.6SOT-23
2SD602ANPN20050060505853400.6SOT-23
2SD667NPN9001000120805603201TO-92L
2SD667NPN9001000120805603201TO-92MOD
2SD667ANPN90010001201005602001TO-92L
2SD667ANPN90010001201005603201TO-92MOD
2SD669NPN100015001801205603201TO-126
2SD669ANPN75015001801605603201TO-92L
2SD669ANPN100015001801605603201TO-126
2SD669ALNPN110002001706.51003200.9TO-126
2SD718NPN300080001201205551602.5TO-3P
2SD789NPN75010001005061008000.3TO-92L
2SD789NPN90010001005061008000.3TO-92MOD
2SD874NPN500100030255853400.4SOT-89-3L
2SD874ANPN500100060505853400.4SOT-89-3L
2SD879NPN750300030106140-0.4TO-92
2SD880NPN1500300060607603001TO-220-3L
2SD882NPN2000300040306604000.5TO-220-3L
2SD886NPN10003000505051004000.5TO-126
2SD965NPN7505000402072308001SOT-89-3L
2SD965ANPN7505000403072308001SOT-89-3L
2SD999NPN500100030255904000.4SOT-89-3L
3CA1837PNP1500100023023051003201.5TO-220F
3CA2050PNP150015001801606602401TO-220F
3CA753PNP12002000403051004002TO-251-3L
3CA753PNP12002000403051004002TO-252-2L(4R)
3CA772PNP1250300040306604000.5TO-126
3CA8772PNP1250300040306604000.5TO-126
3CG751PNP9001500303051004002TO-92MOD
3CG8551PNP7502000504051003201TO-92L
3DA4793NPN1500100023023051003201.5TO-220F
3DA5200ANPN3000150002002005551603TO-3P
3DA5200BNPN3000150001601605551603TO-3P
3DA5200CNPN3000150001201205551603TO-3P
3DA5371NPN150015001801606602401TO-220F
3DA752NPN12002000403051004002TO-251-3L
3DA752NPN12002000403051004002TO-252-2L(4R)
3DA882NPN1250300040306604000.5TO-126
3DD3853NPN2000300060607603001TO-220F
3DG3332NPN62570018016061004000.4TO-92
3DG8051NPN7502000504051003201TO-92L
3DK2222ANPN225600754061003000.6SOT-23
3DK2222ANPN625600754061003000.6TO-92
8050SNPN62550040255854000.6TO-92
8050SSNPN1000150040255853000.5TO-92
8550SPNP62550040255854000.6TO-92
8550SSPNP1000150040255853000.5TO-92
A1015PNP40015050505704000.3TO-92
A1015PNP200150505051304000.3SOT-23
A42NPN50050031030551003000.2SOT-89-3L
A42NPN6255003103055802500.2TO-92
A44NPN5003004004006502000.75SOT-89-3L
A44NPN6252004004005803000.3TO-92
A733PNP200150605051204750.3SOT-23
A733PNP25010060505906000.3TO-92
A92PNP50050031030551003000.2SOT-89-3L
A92PNP6255003103055802500.2TO-92
A94PNP5003004004005803000.3SOT-89-3L
A94PNP6252004004005803000.3TO-92
B772PNP500300040306604000.5SOT-89-3L
B772PNP1250300040306604000.5SOT-223(8R)
B772PNP1250300040306604000.5TO-126
B772MPNP1250300040306604000.5TO-251-3L
B772MPNP1250300040306604000.5TO-252-2L(4R)
B772SPNP625300040306604000.5TO-92
BC212PNP350100605051406000.6TO-92
BC237NPN350100504561208000.6TO-92
BC238NPN350100302551208000.8TO-92
BC307PNP500100504551208000.6TO-92
BC308PNP500100302551208000.6TO-92
BC309PNP500100302551208000.6TO-92
BC327PNP625800504551006300.7TO-92
BC328PNP625800302551006300.7TO-92
BC337NPN625800504551006300.7TO-92
BC338NPN625800302551006300.7TO-92
BC347NPN30010050455404500.3TO-92
BC350PNP30010050455404500.3TO-92
BC368NPN625100025205853750.5TO-92
BC369PNP625100025205853750.5TO-92
BC546NPN625100806561108000.3TO-92
BC547NPN625100504561108000.3TO-92
BC548NPN625100303051108000.3TO-92
BC556PNP625100806551208000.65TO-92
BC557PNP625100504551208000.65TO-92
BC558PNP625100303051208000.65TO-92
BC635NPN830100045455402500.5TO-92
BC636PNP830100045455632500.5TO-92
BC637NPN830100060605632500.5TO-92
BC638PNP830100060605632500.5TO-92
BC639NPN8301000100805632500.5TO-92
BC640PNP8301000100805632500.5TO-92
BC807PNP300500504551006000.7SOT-23
BC807WPNP200500504551006000.7SOT-323
BC808PNP300800302551006300.7SOT-23
BC817NPN300500504551006000.7SOT-23
BC817WNPN200500504551006000.7SOT-323
BC818NPN300500302551006300.7SOT-23
BC846NPN200100806561104500.5SOT-23
BC846WNPN150100806561104500.6SOT-323
BC847NPN200100504561108000.5SOT-23
BC847TNPN150100504561108000.6SOT-523
BC847WNPN150100504561108000.6SOT-323
BC848NPN200100303061108000.5SOT-23
BC848WNPN150100303051108000.6SOT-323
BC856PNP200100806551254750.5SOT-23
BC856WPNP150100806551254750.65SOT-323
BC857PNP200100504551258000.5SOT-23
BC857TPNP150100504561258000.65SOT-523
BC857WPNP150100504551258000.65SOT-323
BC858PNP200100303051258000.5SOT-23
BC858WPNP150100303051258000.65SOT-323
BC868NPN500100032205853750.5SOT-89-3L
BC869PNP5001000322051003750.5SOT-89-3L
BCP51PNP1500100045455632500.5SOT-223(8R)
BCP52PNP1500100060605632500.5SOT-223(8R)
BCP53PNP15001000100805632500.5SOT-223(8R)
BCP54NPN1500100045455632500.5SOT-223(8R)
BCP55NPN1500100060605632500.5SOT-223(8R)
BCP56NPN15001000100805632500.5SOT-223(8R)
BCP68NPN1000100032205853750.5SOT-223(8R)
BCP69PNP1000100032205853750.5SOT-223(8R)
BCW61PNP250100323251206300.55SOT-23
BCW65NPN225800603251006300.7SOT-23
BCW66NPN200800754551006300.7SOT-23
BCW68PNP330800604551006300.7SOT-23
BCX19NPN225500504551006000.62SOT-23
BCX51PNP500100045455632500.5SOT-89-3L
BCX52PNP500100060605632500.5SOT-89-3L
BCX53PNP5001000100805632500.5SOT-89-3L
BCX54NPN500100045455632500.5SOT-89-3L
BCX55NPN500100060605632500.5SOT-89-3L
BCX56NPN5001000100805632500.5SOT-89-3L
BCX69PNP800100025205853750.5SOT-89-3L
BCX70JNPN250200454552504600.55SOT-23
BCX70KNPN250200454553806300.55SOT-23
BD034PNP90025001109571005600.5TO-92MOD
BD034PNP125025001109571005600.5TO-126
BD135NPN1250150045455402500.5TO-126
BD136PNP1250150045455402500.5TO-126
BD137NPN1250150060605402500.5TO-126
BD138PNP1250150060605402500.5TO-126
BD139NPN1250150080805402500.5TO-126
BD140PNP1250150080805402500.5TO-126
BD233NPN125020004545540-0.6TO-126
BD234PNP125025004545540-0.6TO-126
BD235NPN125020006060540-0.6TO-126
BD236PNP125020006060540-0.6TO-126
BD237NPN1250200010080540-0.6TO-126
BD238PNP1250200010080540-0.6TO-126
BD433NPN1250400022225853750.5TO-126
BD434PNP1250400022225853750.5TO-126
BD435NPN1250400032325853750.5TO-126
BD436PNP1250400032325853750.5TO-126
BD437NPN1250400045455853750.6TO-126
BD438PNP1250400045455853750.7TO-126
BD439NPN1250400060605404750.8TO-126
BD440PNP1250400060605404750.8TO-126
BD441NPN1250400080805404750.8TO-126
BD442PNP1250400080805404750.8TO-126
BF240NPN3002540404672200.3TO-92
BF370NPN50010040154.5402000.2TO-92
BF420NPN830100300300550-0.6TO-92
BF421PNP830100300300550-0.6TO-92
BF422NPN830100250250550-0.6TO-92
BF423PNP830100250250550-0.6TO-92
BF483NPN830100300250520-0.6TO-92
BF485NPN830100350300520-0.6TO-92
BF487NPN830100400350520-0.6TO-92
BF620NPN50050300300550-0.6SOT-89-3L
BF622NPN50050250250550-0.6SOT-89-3L
BF820NPN25050300300550-0.6SOT-23
BF821PNP25050300300550-0.8SOT-23
BF822NPN25050250250550-0.6SOT-23
BF823PNP25050250250550-0.8SOT-23
BFS20NPN2502530204401200.3SOT-23
BSR33PNP5001000908051003000.5SOT-89-3L
BSR43NPN5001000908051003000.5SOT-89-3L
BST39NPN500100400350540+-0.5SOT-89-3L
BST40NPN500100300250540+-0.5SOT-89-3L
BU406NPN200070004002006501001TO-220-3L
C1815NPN200150605051304000.25SOT-23
C1815NPN40015060505707000.25TO-92
C945NPN200150605051304000.3SOT-23
C945NPN40015060505707000.3TO-92
CJ10P20DE6PNP35025002020515-0.35SOT-23-6L
CJ201NLNPN3001000302053000.25SOT-23
CJ303NLNPN6253000503551004000.15SOT-89-3L
CJ303NLNPN6253000503551004000.15TO-92
CJ303PLPNP5003000503551004000.4SOT-89-3L
CJ818BPNP350300030305100-0.8SOT-23-6L
CJL818CPNP3502000303051003000.35SOT-23-6L
CJN5616NPN1.2511008051203000.5TO-126
CJP718PNP1000600025207.5300-0.35DFNWB2×2-3L(P0.65/0.75/0.85)
CXT5401PNP5005001601505603000.5SOT-89-3L
CXT5551NPN5006001801606803000.2SOT-89-3L
CZT31CNPN100030001001005101001.2SOT-223
CZT32CPNP100030001001005101001.2SOT-223
CZT5401PNP10006001601505603000.5SOT-223
CZT5551NPN10006001801606802500.2SOT-223(8R)
D882NPN500300040306604000.5SOT-89-3L
D882NPN1500300040306604000.5SOT-223(8R)
D882NPN1250300040306604000.5TO-126
D882HNPN500300070706604000.5SOT-89-3L
D882MNPN1250300040305604000.5TO-251-3L
D882MNPN1250300040305604000.5TO-252-2L(4R)
D882SNPN625300040306604000.5TO-92
D965NPN75050004222634020000.35TO-92
D965VNPN750500022156120020000.35TO-92
FCX591PNP5001000806051003000.6SOT-89-3L
FMMT4124NPN330200302551203600.3SOT-23
FMMT449NPN2001000503051003001SOT-23
FMMT491NPN2501000806051003000.5SOT-23
FMMT493NPN250100012010051003000.6SOT-23
FMMT591PNP2501000806051003000.6SOT-23
FMMT593PNP250100012010051003000.3SOT-23
FMMT618NPN3502500202051000.2SOT-23
FMMT619NPN350200050505200-0.22SOT-23
FMMT718PNP3501.5202071500.22SOT-23
FMMT720PNP350150040405180-0.33SOT-23
FZT692B*NPN8002500707055000.5SOT-223(8R)
FZT753*PNP800200012010051003000.5SOT-223(8R)
FZT954PNP800500014010071003000.34SOT-223(8R)
FZT955PNP800400018014061003000.37SOT-223(8R)
HM4033PNP500100080805100-0.5SOT-89-3L
HM879NPN500300030106140-0.4SOT-89-3L
KSA1150PNP30050040205404000.4TO-92S
KSA1175PNP25015060505407000.3TO-92S
KSA1182PNP15050035305702400.25SOT-23
KSA1220PNP125012001201205603200.7TO-126
KSA1220APNP125012001601605603200.7TO-126
KSA539PNP40020060455402400.5TO-92
KSA614FPNP2000300080555402400.5TO-220F
KSA642PNP40030030255704000.6TO-92
KSA643PNP50050040205404000.4TO-92
KSA708PNP80070080608402400.7TO-92
KSA708PNP80070080608402400.7TO-92L
KSA910PNP800501501505402400.8TO-92MOD
KSA916PNP9008001201205802401TO-92L
KSA928APNP7502000303051003202TO-92L
KSA928APNP10002000303051003202TO-92MOD
KSA931PNP75070080608403201.2TO-92L
KSA931PNP100070080608403200.7TO-92MOD
KSB1151PNP12505000606071004000.3TO-126
KSB564APNP800100030255704000.5TO-92
KSB811PNP350100030255704000.5TO-92S
KSC1730NPN2005030155402400.5TO-92
KSC2316NPN9008001201205802401TO-92MOD
KSC2316NPN9008001201205802401TO-92L
KSC2328ANPN10002000303051003202TO-92MOD
KSC2328ANPN7502000303051003202TO-92L
KSC2330NPN10001003003007402400.5TO-92MOD
KSC2330NPN7501003003007402400.5TO-92L
KSC2331NPN75070080608402400.7TO-92L
KSC2331NPN100070080608402400.7TO-92MOD
KSC2690NPN125012001201205603200.7TO-126
KSC2690ANPN125012001601605603200.7TO-126
KSC2785NPN25015060505707000.3TO-92S
KSC5019NPN7502000301061406000.5TO-92
KSC5021FNPN20005000800480715501TO-220F
KSC815NPN40020060455404000.4TO-92
KSD1020NPN350700302551204000.4TO-92S
KSD1021NPN350100040305704000.5TO-92S
KSD1408NPN2000400080805402401.5TO-220F
KSD1691NPN13005000606071004000.3TO-126
KSD471ANPN800100040305704000.5TO-92
KTA1023PNP9008001201205802401TO-92L
KTA1024PNP750501501505702400.8TO-92L
KTA1042DPNP125050001001005702402TO-252-2L(4R)
KTA1241PNP9005000352081003200.5TO-92L
KTA1266PNP62515050505704000.3TO-92
KTA1267PNP40015050505704000.3TO-92S
KTA1270PNP50050035305702400.25TO-92
KTA1271PNP625800353051003200.7TO-92
KTA1273PNP5002000303051003202SOT-89-3L
KTA1273PNP7502000303051003202TO-92L
KTA1274PNP75040080805702400.4TO-92L
KTA1275PNP90010001601606603201.5TO-92L
KTA1276PNP2000300030305702400.8TO-220-3L
KTA1281PNP1000200050505702400.5TO-92MOD
KTA1281PNP750200050505702400.5TO-92L
KTA1297PNP4002000202061204000.5TO-92S
KTA1298PNP200800353051003200.4SOT-23
KTA1504PNP15015050505704000.3SOT-23
KTA1505PNP15050035305704000.25SOT-23
KTA1659PNP200015001601605702401.5TO-220F
KTA1659APNP200015001801805702401.5TO-220F
KTA1663PNP5001500303051003202SOT-89-3L
KTA1664PNP500800353051003200.7SOT-89-3L
KTA1666PNP500200050505702400.5SOT-89-3L
KTA1668PNP500100080605602000.7SOT-89-3L
KTA2014PNP10015050505704000.3SOT-323
KTA2015PNP10050035305702400.25SOT-323
KTA968APNP200015001801805702401.5TO-220-3L
KTB1366PNP2000300060607602001TO-220-3L
KTB1366PNP2000300060607602001TO-220F
KTB1367PNP200050001001005402402TO-220F
KTC1027NPN10008001201205802401TO-92L
KTC2026NPN20003000606071003001TO-220-3L
KTC2238NPN200015001601605702401.5TO-220-3L
KTC2238ANPN200015001801805702401.5TO-220-3L
KTC3192NPN6255035304402400.4TO-92
KTC3194NPN625204030440200-TO-92
KTC3195NPN400204030440200-TO-92S
KTC3197NPN6255030254202000.2TO-92
KTC3198NPN62515060505707000.25TO-92
KTC3199NPN40015050505707000.25TO-92S
KTC3202NPN62550035305704000.25TO-92
KTC3203NPN625800353051003200.5TO-92
KTC3205NPN5002000303051003202SOT-89-3L
KTC3205NPN7502000303051003202TO-92L
KTC3206NPN1000502001505702400.5TO-92L
KTC3207NPN10001003003007301501TO-92L
KTC3227NPN100040080805702400.4TO-92L
KTC3228NPN90010001601606603201.5TO-92L
KTC3229NPN20001003003005302001TO-220-3L
KTC3265NPN200800353051003200.5SOT-23
KTC3875NPN15015060505707000.25SOT-23
KTC3876NPN20050035305704000.25SOT-23
KTC3879NPN1505035304402400.4SOT-23
KTC4075NPN10015060505707000.25SOT-23
KTC4075NPN10015060505707000.25SOT-323
KTC4076NPN10050035305702400.25SOT-323
KTC4077NPN10010012012052007000.3SOT-323
KTC4369NPN2000300030305702400.8TO-220F
KTC4370ANPN200015001801805702401.5TO-220F
KTC4372NPN500502001505702400.5SOT-89-3L
KTC4373NPN5008001201205802401SOT-89-3L
KTC4374NPN50040080805702400.4SOT-89-3L
KTC4375NPN5001500303051003202SOT-89-3L
KTC4376NPN500800353051003200.5SOT-89-3L
KTC4377NPN5002000301061406000.5SOT-89-3L
KTC4378NPN5001000806051003200.5SOT-89-3L
KTC4379NPN500200050505702400.5SOT-89-3L
KTD1146NPN6255000402071207000.4TO-92
KTD1302NPN5003002520122008000.25SOT-89-3L
KTD1304NPN20030025201220010000.25SOT-23
KTD1351NPN2000300060607603001TO-220-3L
KTD1898NPN5001000100805704000.4SOT-89-3L
KTD2058NPN2000300060607602001TO-220-3L
KTD2058NPN2000300060607602001TO-220F
KTD2061NPN200020002001805702401TO-220F
KTD863NPN1000100060605603200.5TO-92L
KTD998NPN3000100001201205551602.5TO-3P
M28SNPN20010004020630010000.55SOT-23
M28SNPN62510004020630010000.55TO-92
M8050NPN20080040256804000.5SOT-23
M8050NPN62580040256804000.5TO-92
M8050SNPN62580040256804000.5TO-92
M8550PNP20080040256854000.5SOT-23
M8550PNP62580040256804000.5TO-92
M8550SPNP62580040256804000.5TO-92
MJD2955PNP12501000070605201008TO-251-3L
MJD2955PNP12501000070605201008TO-252-2L(4R)
MJD3055NPN12501000070605201008TO-251-3L
MJD3055NPN12501000070605201008TO-252-2L(4R)
MJD31CNPN12503000100100515751.2TO-251-3L
MJD31CNPN12503000100100515751.2TO-252-2L(4R)
MJD32CPNP12503000100100515751.2TO-251-3L
MJD32CPNP12503000100100515751.2TO-252-2L(4R)
MJD41CNPN12506000100100515751.5TO-251-3L
MJD41CNPN12506000100100515751.5TO-252-2L(4R)
MJD42CPNP12506000100100515751.5TO-252-2L(4R)
MJD42CPNP12506000100100515751.5TO-251-3L
MJE170PNP1500300060407502501.7TO-126
MJE171PNP1500300080607502501.7TO-126
MJE172PNP15003000100807502501.7TO-126
MJE2955PNP20001000070605201008TO-220-3L
MJE3055NPN20001000070605201008TO-220-3L
MMBT1616NPN3501000605061356000.3SOT-23
MMBT1616ANPN35010001206061356000.3SOT-23
MMBT2222NPN250600753061003001SOT-23
MMBT2222ANPN300600754061003001SOT-23
MMBT2222AMNPN100500754061003001SOT-723
MMBT2222ATNPN150600754061003001SOT-523
MMBT2907PNP250600604051003000.67SOT-23
MMBT2907APNP250600606051003001.6SOT-23
MMBT2907ATPNP150600606051003001.6SOT-523
MMBT3904NPN200200604061003000.3SOT-23
MMBT3904MNPN100200604061003000.3SOT-723
MMBT3904TNPN150200604061003000.3SOT-523
MMBT3906PNP200200404051003000.3SOT-23
MMBT3906MPNP100200404051003000.3SOT-723
MMBT3906TPNP150200404051003000.4SOT-523
MMBT4401NPN300600604061003000.4SOT-23
MMBT4403PNP300600404051003000.4SOT-23
MMBT5401PNP30060016015051003000.5SOT-23
MMBT5550NPN2256001601406602500.25SOT-23
MMBT5551NPN30060018016061003000.2SOT-23
MMBT589PNP3101000503051003000.65SOT-23
MMBTA05NPN300500606041004000.25SOT-23
MMBTA06NPN300500808041004000.25SOT-23
MMBTA42NPN35050030030051002000.2SOT-23
MMBTA43NPN350500200200540-0.5SOT-23
MMBTA44NPN3503004004006502000.75SOT-23
MMBTA55PNP225500606041004000.25SOT-23
MMBTA56PNP225500808041004000.25SOT-23
MMBTA92PNP30050030030051002000.2SOT-23
MMBTA93PNP350500200200540-0.5SOT-23
MMBTA94PNP3503004004005803000.3SOT-23
MMBTH10NPN225503025360-0.5SOT-23
MMST2222ANPN200600754061003001SOT-323
MMST2907APNP200600606051003001.6SOT-323
MMST3904NPN200200604051003000.3SOT-323
MMST3906PNP200200404051003000.3SOT-323
MMST4401NPN200600604061003000.75SOT-323
MMST4403PNP200600404051003000.75SOT-323
MMST5401PNP2006001601505603000.5SOT-323
MMST5551NPN2006001801606803000.2SOT-323
MMSTA42NPN20050030030051002000.2SOT-323
MMSTA56PNP2005008080450-0.25SOT-323
MMSTA92PNP20050031030551002000.2SOT-323
MPS2222NPN625600603051003001TO-92
MPS2222ANPN625600754061003000.6TO-92
MPS2907PNP625600604051003000.67TO-92
MPS2907APNP625600606051003000.67TO-92
MPS3702PNP62580040255603000.25TO-92
MPS651NPN62520008060575-0.5TO-92
MPS750PNP625200060405754000.3TO-92
MPS751PNP62520008060575-0.5TO-92
MPSA05NPN62550060604100-0.25TO-92
MPSA06NPN625500808041004000.25TO-92
MPSA17NPN300100-40122008000.25TO-92
MPSA43NPN6252002002006402000.4TO-92
MPSA44NPN6253004004006502000.75TO-92
MPSA55PNP62550060604100-0.25TO-92
MPSA56PNP62550080804100-0.25TO-92
MPSA93PNP625500200200540-0.4TO-92
MPSH10NPN350403025360-0.5TO-92
MPSL51PNP6252001001004402500.3TO-92
MPSW01ANPN62510005040560-0.5TO-92
MPSW51PNP62510004030560-0.7TO-92
MPSW51APNP62510005040560-0.7TO-92
PH2369NPN50020040154.5401200.25TO-92
PXT2222ANPN500600754061003001SOT-89-3L
PXT2907APNP500600606051003001.6SOT-89-3L
PXT3904NPN500200604061003000.3SOT-89-3L
PXT3906PNP500200404061003000.4SOT-89-3L
PXT8050NPN500150040255854000.5SOT-89-3L
PXT8550PNP500150040255854000.5SOT-89-3L
PZT2222ANPN1000600754061003001SOT-223(8R)
PZT2907APNP1000600606051003001.6SOT-223(8R)
PZT3904NPN1000200604061003000.2SOT-223(8R)
PZT3906PNP1000200404051003000.4SOT-223
PZT4401NPN1000600604061003000.75SOT-223(8R)
PZT4403PNP1000600404061003000.75SOT-223
PZTA06NPN100050080804100-0.25SOT-223
PZTA42NPN1000500300300640-0.5SOT-223(8R)
PZTA44NPN10003004004006502000.75SOT-223(8R)
PZTA56*PNP100050080804100-0.25SOT-223
PZTA92PNP1000500300300525-0.5SOT-223(8R)
PZTA94PNP10003004004005803000.3SOT-223(8R)
S8050NPN300500402551204000.6SOT-23
S8050NPN62550040255854000.6TO-92
S8550PNP62550040255854000.6TO-92
S8550PNP300500402551204000.6SOT-23
S9012PNP300500402551204000.6SOT-23
S9012PNP62550040255644000.6TO-92
S9012WPNP200500402551204000.6SOT-323
S9013NPN300500402551204000.6SOT-23
S9013NPN62550040255644000.6TO-92
S9013WNPN200500402551204000.6SOT-323
S9014NPN2001005045520010000.3SOT-23
S9014NPN450100504556010000.3TO-92
S9014WNPN2001005045520010000.3SOT-323
S9015PNP450100504556010000.3TO-92
S9015PNP2001005045520010000.3SOT-23
S9015WPNP2001005045520010000.3SOT-323
S9018NPN4005025184282700.5TO-92
S9018NPN2005030155701900.5SOT-23
S9018WNPN2005030155701900.5SOT-323
SS8050NPN2501500402551204000.5SOT-323
SS8050NPN3001500402551204000.5SOT-23
SS8050NPN1000150040255854000.5TO-92
SS8550PNP3001500402551204000.5SOT-323
SS8550PNP3001500402551204000.5SOT-23
SS8550PNP1000150040255854000.5TO-92
STA124PNP625100015126.52004500.4TO-92
STB1277PNP6252000303051003200.8TO-92
STBV32/BNPN1100100070040098351.5TO-92
STC128NPN625100020156.5150-0.3TO-92
STC128NPN400100020156.5150-0.3TO-92S
STD123SNPN350100020156.5150-0.3SOT-23
TIP31NPN200030004040515751.2TO-220-3L
TIP31CNPN20003000100100515751.2TO-220-3L
TIP32PNP200030004040515751.2TO-220-3L
TIP32CPNP20003000100100515751.2TO-220-3L
TIP32CFPNP20003000100100515751.2TO-220F
TIP41NPN200060004040515751.5TO-220-3L
TIP41CNPN20006000100100515751.5TO-220-3L
TIP42PNP200060004040515751.5TO-220-3L
TIP42CPNP20006000100100515751.5TO-220-3L
TIP42CFPNP20006000100100515751.5TO-220F
TK3904LED03NPN100200604061004000.3WBFBP-03E(1.0×0.6×0.5)
TK3906LED03PNP100200404051003000.4WBFBP-03E(1.0×0.6×0.5)
TP847LED03NPN100100504562204750.4
TP856LED03PNP100100806552204750.5WBFBP-03E(1.0×0.6×0.5)
TP857LED03PNP100100504562204750.4
TPT5609NPN750100025205602400.5TO-92L
TPT5610PNP1000100025205602400.5TO-92L
TSC1417NPN6253020153292700.5TO-92
ZTX450NPN6251000604551003000.25TO-92
ZUMT491NPN2501000806051003000.5SOT-323
技术资料